About methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate
methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate (PubChem CID 166697784) has the molecular formula C7H10O3S
and a molecular weight of 174.22 g/mol. Its IUPAC name is methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate.
Molecular Properties
| Compound Name | methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate |
| PubChem CID | 166697784 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate |
| SMILES | COS(=O)C1C=CC=CC1O |
| InChI | InChI=1S/C7H10O3S/c1-10-11(9)7-5-3-2-4-6(7)8/h2-8H,1H3 |
| InChIKey | NPVNHFMXMQQUKC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate?
The IUPAC name of methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate (CID 166697784) is methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate.
What is the SMILES notation for methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate?
The canonical SMILES for methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate is COS(=O)C1C=CC=CC1O.
What is the InChIKey of methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate?
The InChIKey is NPVNHFMXMQQUKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S/c1-10-11(9)7-5-3-2-4-6(7)8/h2-8H,1H3.
What are the key properties of methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate?
methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate has a molecular weight of 174.22 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-hydroxycyclohexa-2,4-diene-1-sulfinate is sourced from PubChem (CID 166697784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).