C35H37N3O3S — CID 166697839
3-[3-[3-[[1-(2,5-dimethylbenzoyl)pyrrolidin-3-yl]methyl]anilino]sulfanyl-4-methoxyphenyl]-N-methylbenzamide (PubChem CID 166697839) has the molecular formula C35H37N3O3S and a molecular weight of 579.77 g/mol. Its IUPAC name is 3-[3-[3-[[1-(2,5-dimethylbenzoyl)pyrrolidin-3-yl]methyl]anilino]sulfanyl-4-methoxyphenyl]-N-methylbenzamide.
| Compound Name | 3-[3-[3-[[1-(2,5-dimethylbenzoyl)pyrrolidin-3-yl]methyl]anilino]sulfanyl-4-methoxyphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 166697839 |
| Molecular Formula | C35H37N3O3S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 3-[3-[3-[[1-(2,5-dimethylbenzoyl)pyrrolidin-3-yl]methyl]anilino]sulfanyl-4-methoxyphenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(OC)c(SNc3cccc(CC4CCN(C(=O)c5cc(C)ccc5C)C4)c3)c2)c1 |
| InChI | InChI=1S/C35H37N3O3S/c1-23-11-12-24(2)31(17-23)35(40)38-16-15-26(22-38)18-25-7-5-10-30(19-25)37-42-33-21-28(13-14-32(33)41-4)27-8-6-9-29(20-27)34(39)36-3/h5-14,17,19-21,26,37H,15-16,18,22H2,1-4H3,(H,36,39) |
| InChIKey | GBRPJVZSMXVUGC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|