About 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine
3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine (PubChem CID 166697958) has the molecular formula C21H29N
and a molecular weight of 295.47 g/mol. Its IUPAC name is 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine.
Molecular Properties
| Compound Name | 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine |
| PubChem CID | 166697958 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine |
| SMILES | CCC/C(=C\C[C@H](C)CC)c1ccc(C#CC2CNC2)cc1 |
| InChI | InChI=1S/C21H29N/c1-4-6-20(12-7-17(3)5-2)21-13-10-18(11-14-21)8-9-19-15-22-16-19/h10-14,17,19,22H,4-7,15-16H2,1-3H3/b20-12+/t17-/m1/s1 |
| InChIKey | LRQRZARIZGFKOQ-XNHPLOEXSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine?
The IUPAC name of 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine (CID 166697958) is 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine.
What is the SMILES notation for 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine?
The canonical SMILES for 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine is CCC/C(=C\C[C@H](C)CC)c1ccc(C#CC2CNC2)cc1.
What is the InChIKey of 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine?
The InChIKey is LRQRZARIZGFKOQ-XNHPLOEXSA-N. The full InChI is InChI=1S/C21H29N/c1-4-6-20(12-7-17(3)5-2)21-13-10-18(11-14-21)8-9-19-15-22-16-19/h10-14,17,19,22H,4-7,15-16H2,1-3H3/b20-12+/t17-/m1/s1.
What are the key properties of 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine?
3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine has a molecular weight of 295.47 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-[(E,7R)-7-methylnon-4-en-4-yl]phenyl]ethynyl]azetidine is sourced from PubChem (CID 166697958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).