About 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine
1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine (PubChem CID 166698185) has the molecular formula C10H13F6N
and a molecular weight of 261.21 g/mol. Its IUPAC name is 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine |
| PubChem CID | 166698185 |
| Molecular Formula | C10H13F6N |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine |
| SMILES | CC1C(C(F)(F)F)C=C(C(F)(F)F)CC1(C)N |
| InChI | InChI=1S/C10H13F6N/c1-5-7(10(14,15)16)3-6(9(11,12)13)4-8(5,2)17/h3,5,7H,4,17H2,1-2H3 |
| InChIKey | QZCYIBJONBZLRK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine?
The IUPAC name of 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine (CID 166698185) is 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine.
What is the SMILES notation for 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine?
The canonical SMILES for 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine is CC1C(C(F)(F)F)C=C(C(F)(F)F)CC1(C)N.
What is the InChIKey of 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine?
The InChIKey is QZCYIBJONBZLRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F6N/c1-5-7(10(14,15)16)3-6(9(11,12)13)4-8(5,2)17/h3,5,7H,4,17H2,1-2H3.
What are the key properties of 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine?
1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine has a molecular weight of 261.21 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-3,5-bis(trifluoromethyl)cyclohex-3-en-1-amine is sourced from PubChem (CID 166698185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).