C23H26F4N4O3 — CID 166698265
(1S,2S,3R,5S)-3-[3-(1-aminoethenyl)-4-fluoro-2-(methylideneamino)pyrrol-1-yl]-5-[[(4R)-6-(difluoromethyl)-5-fluoro-4-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol (PubChem CID 166698265) has the molecular formula C23H26F4N4O3 and a molecular weight of 482.48 g/mol. Its IUPAC name is (1S,2S,3R,5S)-3-[3-(1-aminoethenyl)-4-fluoro-2-(methylideneamino)pyrrol-1-yl]-5-[[(4R)-6-(difluoromethyl)-5-fluoro-4-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol.
| Compound Name | (1S,2S,3R,5S)-3-[3-(1-aminoethenyl)-4-fluoro-2-(methylideneamino)pyrrol-1-yl]-5-[[(4R)-6-(difluoromethyl)-5-fluoro-4-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166698265 |
| Molecular Formula | C23H26F4N4O3 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (1S,2S,3R,5S)-3-[3-(1-aminoethenyl)-4-fluoro-2-(methylideneamino)pyrrol-1-yl]-5-[[(4R)-6-(difluoromethyl)-5-fluoro-4-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol |
| SMILES | C=Nc1c(C(=C)N)c(F)cn1[C@@H]1C[C@H](Oc2cc(C(F)F)c(F)c3c2CNC[C@@H]3C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H26F4N4O3/c1-9-6-30-7-12-15(4-11(22(26)27)19(25)17(9)12)34-16-5-14(20(32)21(16)33)31-8-13(24)18(10(2)28)23(31)29-3/h4,8-9,14,16,20-22,30,32-33H,2-3,5-7,28H2,1H3/t9-,14+,16-,20-,21+/m0/s1 |
| InChIKey | OCOAPOQITCRDIH-IBZWPOMASA-N |
| XLogP | 3.29 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|