About N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine
N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine (PubChem CID 166698374) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine |
| PubChem CID | 166698374 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine |
| SMILES | CCNCCCN1CCN=C1C |
| InChI | InChI=1S/C9H19N3/c1-3-10-5-4-7-12-8-6-11-9(12)2/h10H,3-8H2,1-2H3 |
| InChIKey | YACBVDNSBCOOBO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine?
The IUPAC name of N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine (CID 166698374) is N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine.
What is the SMILES notation for N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine?
The canonical SMILES for N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine is CCNCCCN1CCN=C1C.
What is the InChIKey of N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine?
The InChIKey is YACBVDNSBCOOBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3/c1-3-10-5-4-7-12-8-6-11-9(12)2/h10H,3-8H2,1-2H3.
What are the key properties of N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine?
N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine has a molecular weight of 169.27 g/mol, XLogP of 0.72, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-(2-methyl-4,5-dihydroimidazol-1-yl)propan-1-amine is sourced from PubChem (CID 166698374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).