C18H37FN2 — CID 166698384
4-N-fluoro-1-N-methyl-4-N-(2,5,5,6-tetramethylheptan-2-yl)cyclohexane-1,4-diamine (PubChem CID 166698384) has the molecular formula C18H37FN2 and a molecular weight of 300.51 g/mol. Its IUPAC name is 4-N-fluoro-1-N-methyl-4-N-(2,5,5,6-tetramethylheptan-2-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-fluoro-1-N-methyl-4-N-(2,5,5,6-tetramethylheptan-2-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 166698384 |
| Molecular Formula | C18H37FN2 |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | 4-N-fluoro-1-N-methyl-4-N-(2,5,5,6-tetramethylheptan-2-yl)cyclohexane-1,4-diamine |
| SMILES | CNC1CCC(N(F)C(C)(C)CCC(C)(C)C(C)C)CC1 |
| InChI | InChI=1S/C18H37FN2/c1-14(2)17(3,4)12-13-18(5,6)21(19)16-10-8-15(20-7)9-11-16/h14-16,20H,8-13H2,1-7H3 |
| InChIKey | IXCMSAKYZCKZCV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|