C20H24N4O3 — CID 16670089
7-piperidin-3-yl-2-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 16670089) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 7-piperidin-3-yl-2-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-piperidin-3-yl-2-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 16670089 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 7-piperidin-3-yl-2-(3,4,5-trimethoxyphenyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | COc1cc(-c2cc3nccc(C4CCCNC4)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N4O3/c1-25-17-9-14(10-18(26-2)20(17)27-3)15-11-19-22-8-6-16(24(19)23-15)13-5-4-7-21-12-13/h6,8-11,13,21H,4-5,7,12H2,1-3H3 |
| InChIKey | DZVGLEVXTSTFPR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |