C37H35NO — CID 166701136
(2Z,4E)-5-[5-[10,10-dimethyl-8-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclopenta-1,3-dien-1-yl]-7H-benzo[a]azulen-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile (PubChem CID 166701136) has the molecular formula C37H35NO and a molecular weight of 509.69 g/mol. Its IUPAC name is (2Z,4E)-5-[5-[10,10-dimethyl-8-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclopenta-1,3-dien-1-yl]-7H-benzo[a]azulen-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-[5-[10,10-dimethyl-8-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclopenta-1,3-dien-1-yl]-7H-benzo[a]azulen-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 166701136 |
| Molecular Formula | C37H35NO |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | (2Z,4E)-5-[5-[10,10-dimethyl-8-[4-[(1E)-4-methylpenta-1,3-dienyl]cyclopenta-1,3-dien-1-yl]-7H-benzo[a]azulen-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile |
| SMILES | CC(C)=C/C=C/C1=CC=C(C2=CC3=C(C=CC2)c2ccc(-c4ccc(/C=C/C=C(/C)C#N)o4)cc2C3(C)C)C1 |
| InChI | InChI=1S/C37H35NO/c1-25(2)9-6-11-27-15-16-29(21-27)28-12-8-14-32-33-19-17-30(23-35(33)37(4,5)34(32)22-28)36-20-18-31(39-36)13-7-10-26(3)24-38/h6-11,13-20,22-23H,12,21H2,1-5H3/b11-6+,13-7+,26-10- |
| InChIKey | IMGYRXZJUKZQKT-QEASROMDSA-N |
| XLogP | 10.14 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|