C28H34F2N4O3 — CID 166701150
2-[7-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 166701150) has the molecular formula C28H34F2N4O3 and a molecular weight of 512.60 g/mol. Its IUPAC name is 2-[7-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166701150 |
| Molecular Formula | C28H34F2N4O3 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 2-[7-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(CCCCN3CCN(c4ccc(F)cc4F)CC3)cccc2C1=O |
| InChI | InChI=1S/C28H34F2N4O3/c1-31-27(36)26(9-5-17-35)34-19-23-20(7-4-8-22(23)28(34)37)6-2-3-12-32-13-15-33(16-14-32)25-11-10-21(29)18-24(25)30/h4,7-8,10-11,17-18,26H,2-3,5-6,9,12-16,19H2,1H3,(H,31,36) |
| InChIKey | NQVJIEILMWKTCS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|