C33H42N4O3 — CID 166701480
2-[7-[4-[4-cyano-4-(2,4,6-trimethylphenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 166701480) has the molecular formula C33H42N4O3 and a molecular weight of 542.72 g/mol. Its IUPAC name is 2-[7-[4-[4-cyano-4-(2,4,6-trimethylphenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[4-[4-cyano-4-(2,4,6-trimethylphenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166701480 |
| Molecular Formula | C33H42N4O3 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 2-[7-[4-[4-cyano-4-(2,4,6-trimethylphenyl)piperidin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(CCCCN3CCC(C#N)(c4c(C)cc(C)cc4C)CC3)cccc2C1=O |
| InChI | InChI=1S/C33H42N4O3/c1-23-19-24(2)30(25(3)20-23)33(22-34)13-16-36(17-14-33)15-6-5-9-26-10-7-11-27-28(26)21-37(32(27)40)29(12-8-18-38)31(39)35-4/h7,10-11,18-20,29H,5-6,8-9,12-17,21H2,1-4H3,(H,35,39) |
| InChIKey | LDFNTAIPRLYZCR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|