C11H20FNO — CID 166702433
1-(2,2-Dimethylpropyl)-4-fluoropiperidine-4-carbaldehyde (PubChem CID 166702433) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-fluoropiperidine-4-carbaldehyde.
| Compound Name | 1-(2,2-Dimethylpropyl)-4-fluoropiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 166702433 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-fluoropiperidine-4-carbaldehyde |
| SMILES | CC(C)(C)CN1CCC(CC1)(C=O)F |
| InChI | InChI=1S/C11H20FNO/c1-10(2,3)8-13-6-4-11(12,9-14)5-7-13/h9H,4-8H2,1-3H3 |
| InChIKey | KKQMRQKMRGSFPE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 202 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|