C21H29N5O — CID 166702475
N-[6-[1-imino-3-(methylamino)propan-2-yl]isoquinolin-3-yl]-2-(4-methylpiperidin-1-yl)acetamide (PubChem CID 166702475) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[6-[1-imino-3-(methylamino)propan-2-yl]isoquinolin-3-yl]-2-(4-methylpiperidin-1-yl)acetamide.
| Compound Name | N-[6-[1-imino-3-(methylamino)propan-2-yl]isoquinolin-3-yl]-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 166702475 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-[6-[1-imino-3-(methylamino)propan-2-yl]isoquinolin-3-yl]-2-(4-methylpiperidin-1-yl)acetamide |
| SMILES | [H]/N=C/C(CNC)c1ccc2cnc(NC(=O)CN3CCC(C)CC3)cc2c1 |
| InChI | InChI=1S/C21H29N5O/c1-15-5-7-26(8-6-15)14-21(27)25-20-10-18-9-16(19(11-22)12-23-2)3-4-17(18)13-24-20/h3-4,9-11,13,15,19,22-23H,5-8,12,14H2,1-2H3,(H,24,25,27)/b22-11+ |
| InChIKey | DQYDTOBNVPAWOB-SSDVNMTOSA-N |
| XLogP | 2.86 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|