C15H17N3O3S — CID 16670258
ethyl 2-(4,7-dimethyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)propanoate (PubChem CID 16670258) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is ethyl 2-(4,7-dimethyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)propanoate.
| Compound Name | ethyl 2-(4,7-dimethyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)propanoate |
|---|---|
| PubChem CID | 16670258 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | ethyl 2-(4,7-dimethyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)propanoate |
| SMILES | CCOC(=O)C(C)n1ncc2c3sc(C)cc3n(C)c2c1=O |
| InChI | InChI=1S/C15H17N3O3S/c1-5-21-15(20)9(3)18-14(19)12-10(7-16-18)13-11(17(12)4)6-8(2)22-13/h6-7,9H,5H2,1-4H3 |
| InChIKey | XVJXJNXPDHHACJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |