C22H25F6N3O — CID 166702631
(1S)-1-[(2Z,7E)-7-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-[(2S)-2-bicyclo[3.1.1]heptanyl]-5,6-dihydro-4H-azocin-2-yl]-2,2,2-trifluoroethanol (PubChem CID 166702631) has the molecular formula C22H25F6N3O and a molecular weight of 461.45 g/mol. Its IUPAC name is (1S)-1-[(2Z,7E)-7-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-[(2S)-2-bicyclo[3.1.1]heptanyl]-5,6-dihydro-4H-azocin-2-yl]-2,2,2-trifluoroethanol.
| Compound Name | (1S)-1-[(2Z,7E)-7-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-[(2S)-2-bicyclo[3.1.1]heptanyl]-5,6-dihydro-4H-azocin-2-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 166702631 |
| Molecular Formula | C22H25F6N3O |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (1S)-1-[(2Z,7E)-7-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1-[(2S)-2-bicyclo[3.1.1]heptanyl]-5,6-dihydro-4H-azocin-2-yl]-2,2,2-trifluoroethanol |
| SMILES | Nc1ncc(/C2=C/N([C@H]3CCC4CC3C4)/C([C@H](O)C(F)(F)F)=C\CCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H25F6N3O/c23-21(24,25)16-9-15(10-30-20(16)29)13-3-1-2-4-18(19(32)22(26,27)28)31(11-13)17-6-5-12-7-14(17)8-12/h4,9-12,14,17,19,32H,1-3,5-8H2,(H2,29,30)/b13-11+,18-4-/t12?,14?,17-,19-/m0/s1 |
| InChIKey | AYNXGRBAXDWODO-JTRWTDDTSA-N |
| XLogP | 5.51 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |