About N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide
N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide (PubChem CID 166702749) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide |
| PubChem CID | 166702749 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide |
| SMILES | [H]/N=C/C(C)=C/C=C(\C)NC(C)=O |
| InChI | InChI=1S/C9H14N2O/c1-7(6-10)4-5-8(2)11-9(3)12/h4-6,10H,1-3H3,(H,11,12)/b7-4+,8-5+,10-6+ |
| InChIKey | BGJNBSNCJBGUAX-CFTJBZHISA-N |
| XLogP | 1.62 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide?
The IUPAC name of N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide (CID 166702749) is N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide.
What is the SMILES notation for N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide?
The canonical SMILES for N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide is [H]/N=C/C(C)=C/C=C(\C)NC(C)=O.
What is the InChIKey of N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide?
The InChIKey is BGJNBSNCJBGUAX-CFTJBZHISA-N. The full InChI is InChI=1S/C9H14N2O/c1-7(6-10)4-5-8(2)11-9(3)12/h4-6,10H,1-3H3,(H,11,12)/b7-4+,8-5+,10-6+.
What are the key properties of N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide?
N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide has a molecular weight of 166.22 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4E)-6-imino-5-methylhexa-2,4-dien-2-yl]acetamide is sourced from PubChem (CID 166702749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).