C25H22N4O2S — CID 16670278
2-(7-ethyl-4-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-(2-phenylphenyl)acetamide (PubChem CID 16670278) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-(7-ethyl-4-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-(7-ethyl-4-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16670278 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-(7-ethyl-4-methyl-9-oxo-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-(2-phenylphenyl)acetamide |
| SMILES | CCn1c2cc(C)sc2c2cnn(CC(=O)Nc3ccccc3-c3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C25H22N4O2S/c1-3-28-21-13-16(2)32-24(21)19-14-26-29(25(31)23(19)28)15-22(30)27-20-12-8-7-11-18(20)17-9-5-4-6-10-17/h4-14H,3,15H2,1-2H3,(H,27,30) |
| InChIKey | SOUXXHBCUBXWTP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |