About (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine
(5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine (PubChem CID 166703409) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine.
Molecular Properties
| Compound Name | (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine |
| PubChem CID | 166703409 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine |
| SMILES | [H]/N=C(/C=C(\C=C/C)CC)C(C)CC |
| InChI | InChI=1S/C12H21N/c1-5-8-11(7-3)9-12(13)10(4)6-2/h5,8-10,13H,6-7H2,1-4H3/b8-5-,11-9-,13-12- |
| InChIKey | IZWFJQZPMNFHDD-SEQHGKGBSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine?
The IUPAC name of (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine (CID 166703409) is (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine.
What is the SMILES notation for (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine?
The canonical SMILES for (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine is [H]/N=C(/C=C(\C=C/C)CC)C(C)CC.
What is the InChIKey of (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine?
The InChIKey is IZWFJQZPMNFHDD-SEQHGKGBSA-N. The full InChI is InChI=1S/C12H21N/c1-5-8-11(7-3)9-12(13)10(4)6-2/h5,8-10,13H,6-7H2,1-4H3/b8-5-,11-9-,13-12-.
What are the key properties of (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine?
(5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine has a molecular weight of 179.31 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7Z)-6-ethyl-3-methylnona-5,7-dien-4-imine is sourced from PubChem (CID 166703409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).