About 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine
5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine (PubChem CID 166704946) has the molecular formula C11H16F2N4O
and a molecular weight of 258.27 g/mol. Its IUPAC name is 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine |
| PubChem CID | 166704946 |
| Molecular Formula | C11H16F2N4O |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine |
| SMILES | C[C@@H]1CN(c2ncc(OC(F)F)cn2)C[C@H](C)N1 |
| InChI | InChI=1S/C11H16F2N4O/c1-7-5-17(6-8(2)16-7)11-14-3-9(4-15-11)18-10(12)13/h3-4,7-8,10,16H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | UFKRVBUFNXNGCK-OCAPTIKFSA-N |
| XLogP | 1.26 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine?
The IUPAC name of 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine (CID 166704946) is 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine.
What is the SMILES notation for 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine?
The canonical SMILES for 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine is C[C@@H]1CN(c2ncc(OC(F)F)cn2)C[C@H](C)N1.
What is the InChIKey of 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine?
The InChIKey is UFKRVBUFNXNGCK-OCAPTIKFSA-N. The full InChI is InChI=1S/C11H16F2N4O/c1-7-5-17(6-8(2)16-7)11-14-3-9(4-15-11)18-10(12)13/h3-4,7-8,10,16H,5-6H2,1-2H3/t7-,8+.
What are the key properties of 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine?
5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine has a molecular weight of 258.27 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethoxy)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]pyrimidine is sourced from PubChem (CID 166704946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).