C30H38N4O3 — CID 166705791
5-[1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)hex-5-ynyl]-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 166705791) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is 5-[1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)hex-5-ynyl]-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 5-[1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)hex-5-ynyl]-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 166705791 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 5-[1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)hex-5-ynyl]-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C#CCCCC(C1=CC(C(=O)N[C@H]2CCOc3ccccc32)=CCC1)N1C(=O)CC(CC)(CC)N=C1N |
| InChI | InChI=1S/C30H38N4O3/c1-4-7-8-15-25(34-27(35)20-30(5-2,6-3)33-29(34)31)21-12-11-13-22(19-21)28(36)32-24-17-18-37-26-16-10-9-14-23(24)26/h1,9-10,13-14,16,19,24-25H,5-8,11-12,15,17-18,20H2,2-3H3,(H2,31,33)(H,32,36)/t24-,25?/m0/s1 |
| InChIKey | VGYXEBZUKCHTQA-SKCDSABHSA-N |
| XLogP | 4.55 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|