C29H40N4O3 — CID 166705923
3-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)butyl]-N-[(1R)-2-hydroxy-2-methyl-1,3,3a,7a-tetrahydroinden-1-yl]benzamide (PubChem CID 166705923) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is 3-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)butyl]-N-[(1R)-2-hydroxy-2-methyl-1,3,3a,7a-tetrahydroinden-1-yl]benzamide.
| Compound Name | 3-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)butyl]-N-[(1R)-2-hydroxy-2-methyl-1,3,3a,7a-tetrahydroinden-1-yl]benzamide |
|---|---|
| PubChem CID | 166705923 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 3-[(1R)-1-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)butyl]-N-[(1R)-2-hydroxy-2-methyl-1,3,3a,7a-tetrahydroinden-1-yl]benzamide |
| SMILES | CCC[C@H](c1cccc(C(=O)N[C@@H]2C3C=CC=CC3CC2(C)O)c1)N1C(=O)CC(CC)(CC)N=C1N |
| InChI | InChI=1S/C29H40N4O3/c1-5-11-23(33-24(34)18-29(6-2,7-3)32-27(33)30)19-13-10-14-20(16-19)26(35)31-25-22-15-9-8-12-21(22)17-28(25,4)36/h8-10,12-16,21-23,25,36H,5-7,11,17-18H2,1-4H3,(H2,30,32)(H,31,35)/t21?,22?,23-,25-,28?/m1/s1 |
| InChIKey | MCCDZINSPGYWRR-JNEXIISMSA-N |
| XLogP | 4.25 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |