C21H22F3N5O — CID 166706029
2-[[4-[3-ethenoxy-5-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]methyl]-1-methylimidazo[4,5-b]pyridine (PubChem CID 166706029) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[[4-[3-ethenoxy-5-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]methyl]-1-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-[[4-[3-ethenoxy-5-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]methyl]-1-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 166706029 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[[4-[3-ethenoxy-5-(trifluoromethyl)-2-pyridinyl]piperidin-1-yl]methyl]-1-methylimidazo[4,5-b]pyridine |
| SMILES | C=COc1cc(C(F)(F)F)cnc1C1CCN(Cc2nc3ncccc3n2C)CC1 |
| InChI | InChI=1S/C21H22F3N5O/c1-3-30-17-11-15(21(22,23)24)12-26-19(17)14-6-9-29(10-7-14)13-18-27-20-16(28(18)2)5-4-8-25-20/h3-5,8,11-12,14H,1,6-7,9-10,13H2,2H3 |
| InChIKey | XWXUGBUZBGDLQC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|