C68H64S — CID 166706217
1,7-bis[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzothiophene (PubChem CID 166706217) has the molecular formula C68H64S and a molecular weight of 913.33 g/mol. Its IUPAC name is 1,7-bis[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzothiophene.
| Compound Name | 1,7-bis[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzothiophene |
|---|---|
| PubChem CID | 166706217 |
| Molecular Formula | C68H64S |
| Molecular Weight | 913.33 g/mol |
| Exact Mass | 912.47 |
| IUPAC Name | 1,7-bis[10-(3,5-ditert-butylphenyl)anthracen-9-yl]dibenzothiophene |
| SMILES | CC(C)(C)c1cc(-c2c3ccccc3c(-c3ccc4c(c3)sc3cccc(-c5c6ccccc6c(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c6ccccc56)c34)c3ccccc23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H64S/c1-65(2,3)44-34-42(35-45(39-44)66(4,5)6)61-50-24-15-13-22-48(50)60(49-23-14-16-25-51(49)61)41-32-33-56-59(38-41)69-58-31-21-30-57(64(56)58)63-54-28-19-17-26-52(54)62(53-27-18-20-29-55(53)63)43-36-46(67(7,8)9)40-47(37-43)68(10,11)12/h13-40H,1-12H3 |
| InChIKey | KOECHQCSBSQMAO-UHFFFAOYSA-N |
| XLogP | 20.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.33 |
| LogP ≤ 5 | 20.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|