About 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine
3,4-dimethyl-7-propyl-4,5-dihydrooxazepine (PubChem CID 166706334) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine.
Molecular Properties
| Compound Name | 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine |
| PubChem CID | 166706334 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine |
| SMILES | CCCC1=CCC(C)C(C)=NO1 |
| InChI | InChI=1S/C10H17NO/c1-4-5-10-7-6-8(2)9(3)11-12-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | MEBJBJHDOGUKOO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine?
The IUPAC name of 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine (CID 166706334) is 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine.
What is the SMILES notation for 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine?
The canonical SMILES for 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine is CCCC1=CCC(C)C(C)=NO1.
What is the InChIKey of 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine?
The InChIKey is MEBJBJHDOGUKOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-5-10-7-6-8(2)9(3)11-12-10/h7-8H,4-6H2,1-3H3.
What are the key properties of 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine?
3,4-dimethyl-7-propyl-4,5-dihydrooxazepine has a molecular weight of 167.25 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-7-propyl-4,5-dihydrooxazepine is sourced from PubChem (CID 166706334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).