C7H10N6S — CID 166706614
6-methyl-1,3,5-triazine-2,4-diamine;1,3-thiazole (PubChem CID 166706614) has the molecular formula C7H10N6S and a molecular weight of 210.27 g/mol. Its IUPAC name is 6-methyl-1,3,5-triazine-2,4-diamine;1,3-thiazole.
| Compound Name | 6-methyl-1,3,5-triazine-2,4-diamine;1,3-thiazole |
|---|---|
| PubChem CID | 166706614 |
| Molecular Formula | C7H10N6S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 6-methyl-1,3,5-triazine-2,4-diamine;1,3-thiazole |
| SMILES | Cc1nc(N)nc(N)n1.c1cscn1 |
| InChI | InChI=1S/C4H7N5.C3H3NS/c1-2-7-3(5)9-4(6)8-2;1-2-5-3-4-1/h1H3,(H4,5,6,7,8,9);1-3H |
| InChIKey | YUXVQHNSYRGHFQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |