About 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid
4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid (PubChem CID 166706711) has the molecular formula C11H15NO7S2
and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid.
Molecular Properties
| Compound Name | 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid |
| PubChem CID | 166706711 |
| Molecular Formula | C11H15NO7S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid |
| SMILES | CC(C)(C)O/N=C\c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C11H15NO7S2/c1-11(2,3)19-12-7-8-4-5-9(20(13,14)15)6-10(8)21(16,17)18/h4-7H,1-3H3,(H,13,14,15)(H,16,17,18)/b12-7- |
| InChIKey | QEKOZJOLOYVGGP-GHXNOFRVSA-N |
| XLogP | 1.33 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid?
The IUPAC name of 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid (CID 166706711) is 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid.
What is the SMILES notation for 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid?
The canonical SMILES for 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid is CC(C)(C)O/N=C\c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O.
What is the InChIKey of 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid?
The InChIKey is QEKOZJOLOYVGGP-GHXNOFRVSA-N. The full InChI is InChI=1S/C11H15NO7S2/c1-11(2,3)19-12-7-8-4-5-9(20(13,14)15)6-10(8)21(16,17)18/h4-7H,1-3H3,(H,13,14,15)(H,16,17,18)/b12-7-.
What are the key properties of 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid?
4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid has a molecular weight of 337.38 g/mol, XLogP of 1.33, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-(2-methylpropan-2-yl)oxyiminomethyl]benzene-1,3-disulfonic acid is sourced from PubChem (CID 166706711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).