About azane;6-methylheptyl benzenesulfonate
azane;6-methylheptyl benzenesulfonate (PubChem CID 166707110) has the molecular formula C14H25NO3S
and a molecular weight of 287.42 g/mol. Its IUPAC name is azane;6-methylheptyl benzenesulfonate.
Molecular Properties
| Compound Name | azane;6-methylheptyl benzenesulfonate |
| PubChem CID | 166707110 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | azane;6-methylheptyl benzenesulfonate |
| SMILES | CC(C)CCCCCOS(=O)(=O)c1ccccc1.N |
| InChI | InChI=1S/C14H22O3S.H3N/c1-13(2)9-5-4-8-12-17-18(15,16)14-10-6-3-7-11-14;/h3,6-7,10-11,13H,4-5,8-9,12H2,1-2H3;1H3 |
| InChIKey | JLVCYZZLSIWIRN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze azane;6-methylheptyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-methylheptyl benzenesulfonate?
The IUPAC name of azane;6-methylheptyl benzenesulfonate (CID 166707110) is azane;6-methylheptyl benzenesulfonate.
What is the SMILES notation for azane;6-methylheptyl benzenesulfonate?
The canonical SMILES for azane;6-methylheptyl benzenesulfonate is CC(C)CCCCCOS(=O)(=O)c1ccccc1.N.
What is the InChIKey of azane;6-methylheptyl benzenesulfonate?
The InChIKey is JLVCYZZLSIWIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3S.H3N/c1-13(2)9-5-4-8-12-17-18(15,16)14-10-6-3-7-11-14;/h3,6-7,10-11,13H,4-5,8-9,12H2,1-2H3;1H3.
What are the key properties of azane;6-methylheptyl benzenesulfonate?
azane;6-methylheptyl benzenesulfonate has a molecular weight of 287.42 g/mol, XLogP of 3.77, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-methylheptyl benzenesulfonate is sourced from PubChem (CID 166707110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).