C12H23NO5 — CID 166707254
(3R)-3-hydroxy-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (PubChem CID 166707254) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid.
| Compound Name | (3R)-3-hydroxy-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 166707254 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (3R)-3-hydroxy-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| SMILES | CC(C)[C@@H](O)C(C(=O)O)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO5/c1-7(2)9(14)8(10(15)16)13(6)11(17)18-12(3,4)5/h7-9,14H,1-6H3,(H,15,16)/t8?,9-/m1/s1 |
| InChIKey | OCONKJHFYPZIEV-YGPZHTELSA-N |
| XLogP | 1.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |