C14H22N4O8P2S — CID 166708407
2-[(3S)-3-(1-hydroxyethyl)-6,12-dimethyl-4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),5,9,11-tetraen-5-yl]ethyl phosphono hydrogen phosphate (PubChem CID 166708407) has the molecular formula C14H22N4O8P2S and a molecular weight of 468.37 g/mol. Its IUPAC name is 2-[(3S)-3-(1-hydroxyethyl)-6,12-dimethyl-4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),5,9,11-tetraen-5-yl]ethyl phosphono hydrogen phosphate.
| Compound Name | 2-[(3S)-3-(1-hydroxyethyl)-6,12-dimethyl-4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),5,9,11-tetraen-5-yl]ethyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166708407 |
| Molecular Formula | C14H22N4O8P2S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-[(3S)-3-(1-hydroxyethyl)-6,12-dimethyl-4-thia-2,7,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),5,9,11-tetraen-5-yl]ethyl phosphono hydrogen phosphate |
| SMILES | CC1=C(CCOP(=O)(O)OP(=O)(O)O)S[C@@]2(C(C)O)Nc3nc(C)ncc3CN12 |
| InChI | InChI=1S/C14H22N4O8P2S/c1-8-12(4-5-25-28(23,24)26-27(20,21)22)29-14(9(2)19)17-13-11(7-18(8)14)6-15-10(3)16-13/h6,9,19H,4-5,7H2,1-3H3,(H,23,24)(H,15,16,17)(H2,20,21,22)/t9?,14-/m0/s1 |
| InChIKey | UQFVHIGKDHNMJT-RJSPSEDBSA-N |
| XLogP | 1.64 |
| TPSA | 174.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|