C29H22FN3O2 — CID 166708657
2-[2-[1-[3-(4-fluorophenyl)phenyl]-5,6-dihydro-4H-indazol-7-ylidene]ethyl]isoindole-1,3-dione (PubChem CID 166708657) has the molecular formula C29H22FN3O2 and a molecular weight of 463.51 g/mol. Its IUPAC name is 2-[2-[1-[3-(4-fluorophenyl)phenyl]-5,6-dihydro-4H-indazol-7-ylidene]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1-[3-(4-fluorophenyl)phenyl]-5,6-dihydro-4H-indazol-7-ylidene]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166708657 |
| Molecular Formula | C29H22FN3O2 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[2-[1-[3-(4-fluorophenyl)phenyl]-5,6-dihydro-4H-indazol-7-ylidene]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC=C1CCCc2cnn(-c3cccc(-c4ccc(F)cc4)c3)c21 |
| InChI | InChI=1S/C29H22FN3O2/c30-23-13-11-19(12-14-23)21-6-4-8-24(17-21)33-27-20(5-3-7-22(27)18-31-33)15-16-32-28(34)25-9-1-2-10-26(25)29(32)35/h1-2,4,6,8-15,17-18H,3,5,7,16H2 |
| InChIKey | FBCPEWJXAWPHRU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|