About phosphane;2-quinolin-2-yloxyquinoline
phosphane;2-quinolin-2-yloxyquinoline (PubChem CID 166708861) has the molecular formula C18H15N2OP
and a molecular weight of 306.31 g/mol. Its IUPAC name is phosphane;2-quinolin-2-yloxyquinoline.
Molecular Properties
| Compound Name | phosphane;2-quinolin-2-yloxyquinoline |
| PubChem CID | 166708861 |
| Molecular Formula | C18H15N2OP |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | phosphane;2-quinolin-2-yloxyquinoline |
| SMILES | P.c1ccc2nc(Oc3ccc4ccccc4n3)ccc2c1 |
| InChI | InChI=1S/C18H12N2O.H3P/c1-3-7-15-13(5-1)9-11-17(19-15)21-18-12-10-14-6-2-4-8-16(14)20-18;/h1-12H;1H3 |
| InChIKey | YOFSGAQAKKMBOR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphane;2-quinolin-2-yloxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;2-quinolin-2-yloxyquinoline?
The IUPAC name of phosphane;2-quinolin-2-yloxyquinoline (CID 166708861) is phosphane;2-quinolin-2-yloxyquinoline.
What is the SMILES notation for phosphane;2-quinolin-2-yloxyquinoline?
The canonical SMILES for phosphane;2-quinolin-2-yloxyquinoline is P.c1ccc2nc(Oc3ccc4ccccc4n3)ccc2c1.
What is the InChIKey of phosphane;2-quinolin-2-yloxyquinoline?
The InChIKey is YOFSGAQAKKMBOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O.H3P/c1-3-7-15-13(5-1)9-11-17(19-15)21-18-12-10-14-6-2-4-8-16(14)20-18;/h1-12H;1H3.
What are the key properties of phosphane;2-quinolin-2-yloxyquinoline?
phosphane;2-quinolin-2-yloxyquinoline has a molecular weight of 306.31 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;2-quinolin-2-yloxyquinoline is sourced from PubChem (CID 166708861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).