C30H32N6O4S — CID 166709551
[(3R)-1-[3-(2-azidoethyl)-2-[1-(cyclopropylmethyl)indol-2-yl]-4-methoxy-1-benzothiophene-6-carbonyl]piperidin-3-yl]carbamic acid (PubChem CID 166709551) has the molecular formula C30H32N6O4S and a molecular weight of 572.69 g/mol. Its IUPAC name is [(3R)-1-[3-(2-azidoethyl)-2-[1-(cyclopropylmethyl)indol-2-yl]-4-methoxy-1-benzothiophene-6-carbonyl]piperidin-3-yl]carbamic acid.
| Compound Name | [(3R)-1-[3-(2-azidoethyl)-2-[1-(cyclopropylmethyl)indol-2-yl]-4-methoxy-1-benzothiophene-6-carbonyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 166709551 |
| Molecular Formula | C30H32N6O4S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [(3R)-1-[3-(2-azidoethyl)-2-[1-(cyclopropylmethyl)indol-2-yl]-4-methoxy-1-benzothiophene-6-carbonyl]piperidin-3-yl]carbamic acid |
| SMILES | COc1cc(C(=O)N2CCC[C@@H](NC(=O)O)C2)cc2sc(-c3cc4ccccc4n3CC3CC3)c(CCN=[N+]=[N-])c12 |
| InChI | InChI=1S/C30H32N6O4S/c1-40-25-14-20(29(37)35-12-4-6-21(17-35)33-30(38)39)15-26-27(25)22(10-11-32-34-31)28(41-26)24-13-19-5-2-3-7-23(19)36(24)16-18-8-9-18/h2-3,5,7,13-15,18,21,33H,4,6,8-12,16-17H2,1H3,(H,38,39)/t21-/m1/s1 |
| InChIKey | CXHRSHBIDOCAGF-OAQYLSRUSA-N |
| XLogP | 6.67 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|