C11H14N4O — CID 166710369
2-(12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)ethanol (PubChem CID 166710369) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)ethanol.
| Compound Name | 2-(12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)ethanol |
|---|---|
| PubChem CID | 166710369 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-(12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-4-yl)ethanol |
| SMILES | Cc1nnc2n1C1C=C(CCO)NC1C=C2 |
| InChI | InChI=1S/C11H14N4O/c1-7-13-14-11-3-2-9-10(15(7)11)6-8(12-9)4-5-16/h2-3,6,9-10,12,16H,4-5H2,1H3 |
| InChIKey | CFFRUTLYHARFBA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |