C14H17N3O3 — CID 166710503
(4aS,8aR)-8-(benzylamino)-4,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b]pyrazine-2,3-dione (PubChem CID 166710503) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is (4aS,8aR)-8-(benzylamino)-4,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b]pyrazine-2,3-dione.
| Compound Name | (4aS,8aR)-8-(benzylamino)-4,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 166710503 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (4aS,8aR)-8-(benzylamino)-4,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b]pyrazine-2,3-dione |
| SMILES | O=C1N[C@@H]2C(NCc3ccccc3)COC[C@H]2NC1=O |
| InChI | InChI=1S/C14H17N3O3/c18-13-14(19)17-12-10(7-20-8-11(12)16-13)15-6-9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2,(H,16,18)(H,17,19)/t10?,11-,12-/m1/s1 |
| InChIKey | UGDWBIJZKFEXNR-PQDIPPBSSA-N |
| XLogP | -0.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|