C17H22FN5O3S — CID 16671097
(3R,5S)-5-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 16671097) has the molecular formula C17H22FN5O3S and a molecular weight of 395.46 g/mol. Its IUPAC name is (3R,5S)-5-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-5-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 16671097 |
| Molecular Formula | C17H22FN5O3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (3R,5S)-5-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@@H](C(=O)NCCCn2ccnc2)C[C@@H](c2ccc(F)cc2)NS1(=O)=O |
| InChI | InChI=1S/C17H22FN5O3S/c1-22-16(17(24)20-7-2-9-23-10-8-19-12-23)11-15(21-27(22,25)26)13-3-5-14(18)6-4-13/h3-6,8,10,12,15-16,21H,2,7,9,11H2,1H3,(H,20,24)/t15-,16+/m0/s1 |
| InChIKey | IRAWLBKUGDUHKA-JKSUJKDBSA-N |
| XLogP | 0.81 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|