C19H22ClN3O2 — CID 16671311
(6-chloro-3-pyridinyl)-[(2S)-4-[(3-methoxyphenyl)methyl]-2-methylpiperazin-1-yl]methanone (PubChem CID 16671311) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[(2S)-4-[(3-methoxyphenyl)methyl]-2-methylpiperazin-1-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[(2S)-4-[(3-methoxyphenyl)methyl]-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16671311 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[(2S)-4-[(3-methoxyphenyl)methyl]-2-methylpiperazin-1-yl]methanone |
| SMILES | COc1cccc(CN2CCN(C(=O)c3ccc(Cl)nc3)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-14-12-22(13-15-4-3-5-17(10-15)25-2)8-9-23(14)19(24)16-6-7-18(20)21-11-16/h3-7,10-11,14H,8-9,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | VYWNXPFJRNHADK-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|