About N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide
N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide (PubChem CID 166713700) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide |
| PubChem CID | 166713700 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide |
| SMILES | C=C/C=C(/NC=O)C(=C)COC |
| InChI | InChI=1S/C9H13NO2/c1-4-5-9(10-7-11)8(2)6-12-3/h4-5,7H,1-2,6H2,3H3,(H,10,11)/b9-5+ |
| InChIKey | GABHYWKDJGPWCL-WEVVVXLNSA-N |
| XLogP | 1.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide?
The IUPAC name of N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide (CID 166713700) is N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide.
What is the SMILES notation for N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide?
The canonical SMILES for N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide is C=C/C=C(/NC=O)C(=C)COC.
What is the InChIKey of N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide?
The InChIKey is GABHYWKDJGPWCL-WEVVVXLNSA-N. The full InChI is InChI=1S/C9H13NO2/c1-4-5-9(10-7-11)8(2)6-12-3/h4-5,7H,1-2,6H2,3H3,(H,10,11)/b9-5+.
What are the key properties of N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide?
N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide has a molecular weight of 167.21 g/mol, XLogP of 1.00, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-2-(methoxymethyl)hexa-1,3,5-trien-3-yl]formamide is sourced from PubChem (CID 166713700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).