C28H52N2S — CID 166713812
5-ethyl-1-[8-ethyl-4,6-dimethyl-3-[(E)-3-(propylamino)prop-1-enyl]-4λ6-thiaspiro[3.4]octa-2,4,6-trien-2-yl]-2,5-dimethylheptan-3-amine (PubChem CID 166713812) has the molecular formula C28H52N2S and a molecular weight of 448.81 g/mol. Its IUPAC name is 5-ethyl-1-[8-ethyl-4,6-dimethyl-3-[(E)-3-(propylamino)prop-1-enyl]-4λ6-thiaspiro[3.4]octa-2,4,6-trien-2-yl]-2,5-dimethylheptan-3-amine.
| Compound Name | 5-ethyl-1-[8-ethyl-4,6-dimethyl-3-[(E)-3-(propylamino)prop-1-enyl]-4λ6-thiaspiro[3.4]octa-2,4,6-trien-2-yl]-2,5-dimethylheptan-3-amine |
|---|---|
| PubChem CID | 166713812 |
| Molecular Formula | C28H52N2S |
| Molecular Weight | 448.81 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | 5-ethyl-1-[8-ethyl-4,6-dimethyl-3-[(E)-3-(propylamino)prop-1-enyl]-4λ6-thiaspiro[3.4]octa-2,4,6-trien-2-yl]-2,5-dimethylheptan-3-amine |
| SMILES | CCCNC/C=C/C1=C(CC(C)C(N)CC(C)(CC)CC)CS12(C)=CC(C)=CC2CC |
| InChI | InChI=1S/C28H52N2S/c1-9-15-30-16-13-14-27-24(18-23(6)26(29)19-28(7,11-3)12-4)21-31(27,8)20-22(5)17-25(31)10-2/h13-14,17,20,23,25-26,30H,9-12,15-16,18-19,21,29H2,1-8H3/b14-13+ |
| InChIKey | LFZKLRPWMAFSEA-BUHFOSPRSA-N |
| XLogP | 6.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.81 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|