C65H43N3 — CID 166713937
3-[3-(N-[4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)phenyl]anilino)-5-(3-ethanimidoylphenyl)phenyl]benzonitrile (PubChem CID 166713937) has the molecular formula C65H43N3 and a molecular weight of 866.08 g/mol. Its IUPAC name is 3-[3-(N-[4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)phenyl]anilino)-5-(3-ethanimidoylphenyl)phenyl]benzonitrile.
| Compound Name | 3-[3-(N-[4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)phenyl]anilino)-5-(3-ethanimidoylphenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 166713937 |
| Molecular Formula | C65H43N3 |
| Molecular Weight | 866.08 g/mol |
| Exact Mass | 865.35 |
| IUPAC Name | 3-[3-(N-[4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)phenyl]anilino)-5-(3-ethanimidoylphenyl)phenyl]benzonitrile |
| SMILES | [H]/N=C(\C)c1cccc(-c2cc(-c3cccc(C#N)c3)cc(N(c3ccccc3)c3ccc(-c4ccc5c6c(cccc46)-c4c-5c(-c5ccccc5)c5ccccc5c4-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C65H43N3/c1-42(67)47-21-14-23-49(37-47)51-38-50(48-22-13-16-43(36-48)41-66)39-54(40-51)68(52-24-9-4-10-25-52)53-32-30-44(31-33-53)55-34-35-60-63-56(55)28-15-29-59(63)64-61(45-17-5-2-6-18-45)57-26-11-12-27-58(57)62(65(60)64)46-19-7-3-8-20-46/h2-40,67H,1H3/b67-42+ |
| InChIKey | CBULUXYKUWSPHM-UVJFVMBGSA-N |
| XLogP | 17.70 |
| TPSA | 50.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.08 |
| LogP ≤ 5 | 17.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|