C52H40N4 — CID 166714218
4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-9-tricyclo[6.4.1.04,13]trideca-1(12),2,4,6,8(13),10-hexaenyl]-N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N-phenylcyclohepta-1,3,5-trien-1-amine (PubChem CID 166714218) has the molecular formula C52H40N4 and a molecular weight of 720.92 g/mol. Its IUPAC name is 4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-9-tricyclo[6.4.1.04,13]trideca-1(12),2,4,6,8(13),10-hexaenyl]-N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N-phenylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-9-tricyclo[6.4.1.04,13]trideca-1(12),2,4,6,8(13),10-hexaenyl]-N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N-phenylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 166714218 |
| Molecular Formula | C52H40N4 |
| Molecular Weight | 720.92 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-9-tricyclo[6.4.1.04,13]trideca-1(12),2,4,6,8(13),10-hexaenyl]-N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N-phenylcyclohepta-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C1=C(C)C2=CC=CC(C3=CC=C(N(c4ccccc4)c4ccc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4)CC=C3)c3cccc1c32 |
| InChI | InChI=1S/C52H40N4/c1-3-4-19-43-36(2)44-20-13-21-45(47-23-14-22-46(43)52(44)47)38-15-12-18-41(31-28-38)56(40-16-6-5-7-17-40)42-29-26-37(27-30-42)39-34-50(48-24-8-10-32-53-48)55-51(35-39)49-25-9-11-33-54-49/h3-17,19-35,45H,1,18H2,2H3/b19-4- |
| InChIKey | HYTQIDKETKHSNU-PVOVUMCXSA-N |
| XLogP | 13.05 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.92 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|