About (1-cyclopentyl-2,2-dimethylpropylidene)phosphane
(1-cyclopentyl-2,2-dimethylpropylidene)phosphane (PubChem CID 166714540) has the molecular formula C10H19P
and a molecular weight of 170.24 g/mol. Its IUPAC name is (1-cyclopentyl-2,2-dimethylpropylidene)phosphane.
Molecular Properties
| Compound Name | (1-cyclopentyl-2,2-dimethylpropylidene)phosphane |
| PubChem CID | 166714540 |
| Molecular Formula | C10H19P |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | (1-cyclopentyl-2,2-dimethylpropylidene)phosphane |
| SMILES | [H]/P=C(\C1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C10H19P/c1-10(2,3)9(11)8-6-4-5-7-8/h8,11H,4-7H2,1-3H3 |
| InChIKey | YUJOCQPLWYUIGO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclopentyl-2,2-dimethylpropylidene)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopentyl-2,2-dimethylpropylidene)phosphane?
The IUPAC name of (1-cyclopentyl-2,2-dimethylpropylidene)phosphane (CID 166714540) is (1-cyclopentyl-2,2-dimethylpropylidene)phosphane.
What is the SMILES notation for (1-cyclopentyl-2,2-dimethylpropylidene)phosphane?
The canonical SMILES for (1-cyclopentyl-2,2-dimethylpropylidene)phosphane is [H]/P=C(\C1CCCC1)C(C)(C)C.
What is the InChIKey of (1-cyclopentyl-2,2-dimethylpropylidene)phosphane?
The InChIKey is YUJOCQPLWYUIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19P/c1-10(2,3)9(11)8-6-4-5-7-8/h8,11H,4-7H2,1-3H3.
What are the key properties of (1-cyclopentyl-2,2-dimethylpropylidene)phosphane?
(1-cyclopentyl-2,2-dimethylpropylidene)phosphane has a molecular weight of 170.24 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopentyl-2,2-dimethylpropylidene)phosphane is sourced from PubChem (CID 166714540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).