C50H48N2 — CID 166715792
N-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]cyclohexyl]-9-[4-[4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylcarbazol-2-amine (PubChem CID 166715792) has the molecular formula C50H48N2 and a molecular weight of 676.95 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]cyclohexyl]-9-[4-[4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylcarbazol-2-amine.
| Compound Name | N-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]cyclohexyl]-9-[4-[4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylcarbazol-2-amine |
|---|---|
| PubChem CID | 166715792 |
| Molecular Formula | C50H48N2 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | N-[4-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]cyclohexyl]-9-[4-[4-(5-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylcarbazol-2-amine |
| SMILES | C#C/C=C\C=C(/C)C1CCC(N(c2ccccc2)c2ccc3c4ccccc4n(-c4ccc(C5=CC=C(C6=CC=CC(C)C6)CC5)cc4)c3c2)CC1 |
| InChI | InChI=1S/C50H48N2/c1-4-5-7-14-37(3)38-24-28-44(29-25-38)51(43-16-8-6-9-17-43)46-32-33-48-47-18-10-11-19-49(47)52(50(48)35-46)45-30-26-40(27-31-45)39-20-22-41(23-21-39)42-15-12-13-36(2)34-42/h1,5-20,22,26-27,30-33,35-36,38,44H,21,23-25,28-29,34H2,2-3H3/b7-5-,37-14+ |
| InChIKey | MYDOYUVIQXCNDV-YHJBHHBKSA-N |
| XLogP | 13.24 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|