C14H18N4O7 — CID 166716056
1-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropyl]-3-[2-(2,5-dioxopyrrol-1-yl)ethyl]urea (PubChem CID 166716056) has the molecular formula C14H18N4O7 and a molecular weight of 354.32 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropyl]-3-[2-(2,5-dioxopyrrol-1-yl)ethyl]urea.
| Compound Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropyl]-3-[2-(2,5-dioxopyrrol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 166716056 |
| Molecular Formula | C14H18N4O7 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-hydroxypropyl]-3-[2-(2,5-dioxopyrrol-1-yl)ethyl]urea |
| SMILES | O=C(NCCC(O)ON1C(=O)CCC1=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H18N4O7/c19-9-1-2-10(20)17(9)8-7-16-14(24)15-6-5-13(23)25-18-11(21)3-4-12(18)22/h1-2,13,23H,3-8H2,(H2,15,16,24) |
| InChIKey | XMWIENRSZCXTIE-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|