C13H15N4O9P — CID 166716068
[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-nitrosophosphinic acid (PubChem CID 166716068) has the molecular formula C13H15N4O9P and a molecular weight of 402.26 g/mol. Its IUPAC name is [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-nitrosophosphinic acid.
| Compound Name | [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-nitrosophosphinic acid |
|---|---|
| PubChem CID | 166716068 |
| Molecular Formula | C13H15N4O9P |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-nitrosophosphinic acid |
| SMILES | O=NP(=O)(O)N(CCC(=O)ON1C(=O)CCC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H15N4O9P/c18-9-1-2-10(19)16(9)8-7-15(27(24,25)14-23)6-5-13(22)26-17-11(20)3-4-12(17)21/h1-2H,3-8H2,(H,24,25) |
| InChIKey | AVMWBZXWKNUKFX-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 171.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|