About [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate
[(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate (PubChem CID 166716125) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate |
| PubChem CID | 166716125 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate |
| SMILES | CC1CCC[C@H](OC(=O)C2=CCN[C@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C18H23NO2/c1-13-6-5-9-15(12-13)21-18(20)16-10-11-19-17(16)14-7-3-2-4-8-14/h2-4,7-8,10,13,15,17,19H,5-6,9,11-12H2,1H3/t13?,15-,17-/m0/s1 |
| InChIKey | QVWOETMUIQLUOM-QJOPWCIASA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
The IUPAC name of [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate (CID 166716125) is [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate.
What is the SMILES notation for [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
The canonical SMILES for [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate is CC1CCC[C@H](OC(=O)C2=CCN[C@H]2c2ccccc2)C1.
What is the InChIKey of [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
The InChIKey is QVWOETMUIQLUOM-QJOPWCIASA-N. The full InChI is InChI=1S/C18H23NO2/c1-13-6-5-9-15(12-13)21-18(20)16-10-11-19-17(16)14-7-3-2-4-8-14/h2-4,7-8,10,13,15,17,19H,5-6,9,11-12H2,1H3/t13?,15-,17-/m0/s1.
What are the key properties of [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate?
[(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate has a molecular weight of 285.39 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-3-methylcyclohexyl] (2S)-2-phenyl-2,5-dihydro-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 166716125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).