C45H33N3 — CID 166716137
9-[1-[(Z)-but-1-en-3-ynyl]-2,3,3-trimethylinden-5-yl]-3-(6-carbazol-9-yl-2-pyridinyl)carbazole (PubChem CID 166716137) has the molecular formula C45H33N3 and a molecular weight of 615.78 g/mol. Its IUPAC name is 9-[1-[(Z)-but-1-en-3-ynyl]-2,3,3-trimethylinden-5-yl]-3-(6-carbazol-9-yl-2-pyridinyl)carbazole.
| Compound Name | 9-[1-[(Z)-but-1-en-3-ynyl]-2,3,3-trimethylinden-5-yl]-3-(6-carbazol-9-yl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 166716137 |
| Molecular Formula | C45H33N3 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 9-[1-[(Z)-but-1-en-3-ynyl]-2,3,3-trimethylinden-5-yl]-3-(6-carbazol-9-yl-2-pyridinyl)carbazole |
| SMILES | C#C/C=C\C1=C(C)C(C)(C)c2cc(-n3c4ccccc4c4cc(-c5cccc(-n6c7ccccc7c7ccccc76)n5)ccc43)ccc21 |
| InChI | InChI=1S/C45H33N3/c1-5-6-14-32-29(2)45(3,4)38-28-31(24-25-33(32)38)47-40-19-10-9-17-36(40)37-27-30(23-26-43(37)47)39-18-13-22-44(46-39)48-41-20-11-7-15-34(41)35-16-8-12-21-42(35)48/h1,6-28H,2-4H3/b14-6- |
| InChIKey | VTAACCWTEKDSCV-NSIKDUERSA-N |
| XLogP | 11.20 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|