C15H28S — CID 166716483
(2E,6Z)-3,4,5,6,8-pentamethyldeca-2,6-diene-2-thiol (PubChem CID 166716483) has the molecular formula C15H28S and a molecular weight of 240.46 g/mol. Its IUPAC name is (2E,6Z)-3,4,5,6,8-pentamethyldeca-2,6-diene-2-thiol.
| Compound Name | (2E,6Z)-3,4,5,6,8-pentamethyldeca-2,6-diene-2-thiol |
|---|---|
| PubChem CID | 166716483 |
| Molecular Formula | C15H28S |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (2E,6Z)-3,4,5,6,8-pentamethyldeca-2,6-diene-2-thiol |
| SMILES | CCC(C)/C=C(/C)C(C)C(C)/C(C)=C(\C)S |
| InChI | InChI=1S/C15H28S/c1-8-10(2)9-11(3)12(4)13(5)14(6)15(7)16/h9-10,12-13,16H,8H2,1-7H3/b11-9-,15-14+ |
| InChIKey | MMGZEPFROZMAEN-DVRQTUGZSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|