C31H46O5 — CID 166717026
2-[[(1R,3aR,9aR)-1-[(3R)-3-(cyclohexanecarbonyloxy)-4,6-dimethylheptyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 166717026) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is 2-[[(1R,3aR,9aR)-1-[(3R)-3-(cyclohexanecarbonyloxy)-4,6-dimethylheptyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[(1R,3aR,9aR)-1-[(3R)-3-(cyclohexanecarbonyloxy)-4,6-dimethylheptyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 166717026 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 2-[[(1R,3aR,9aR)-1-[(3R)-3-(cyclohexanecarbonyloxy)-4,6-dimethylheptyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CC(C)CC(C)[C@@H](CC[C@H]1CC[C@@H]2Cc3c(cccc3OCC(=O)O)C[C@H]12)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C31H46O5/c1-20(2)16-21(3)28(36-31(34)23-8-5-4-6-9-23)15-14-22-12-13-25-18-27-24(17-26(22)25)10-7-11-29(27)35-19-30(32)33/h7,10-11,20-23,25-26,28H,4-6,8-9,12-19H2,1-3H3,(H,32,33)/t21?,22-,25-,26-,28-/m1/s1 |
| InChIKey | GVEYBGSTDRBGRQ-PFNIOKPUSA-N |
| XLogP | 6.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |