C22H22ClN3O4 — CID 166717111
4-[[10-[(2E,4Z)-5-amino-4-chlorohepta-2,4,6-trien-2-yl]oxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-yl]oxy]butanenitrile (PubChem CID 166717111) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 4-[[10-[(2E,4Z)-5-amino-4-chlorohepta-2,4,6-trien-2-yl]oxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-yl]oxy]butanenitrile.
| Compound Name | 4-[[10-[(2E,4Z)-5-amino-4-chlorohepta-2,4,6-trien-2-yl]oxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-yl]oxy]butanenitrile |
|---|---|
| PubChem CID | 166717111 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4-[[10-[(2E,4Z)-5-amino-4-chlorohepta-2,4,6-trien-2-yl]oxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-5-yl]oxy]butanenitrile |
| SMILES | C=C/C(N)=C(Cl)\C=C(/C)Oc1ccnc2cc(OCCCC#N)c3c(c12)OCCO3 |
| InChI | InChI=1S/C22H22ClN3O4/c1-3-16(25)15(23)12-14(2)30-18-6-8-26-17-13-19(27-9-5-4-7-24)21-22(20(17)18)29-11-10-28-21/h3,6,8,12-13H,1,4-5,9-11,25H2,2H3/b14-12+,16-15- |
| InChIKey | LBYHYWMYCMVLRK-KDSKZURDSA-N |
| XLogP | 4.57 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|