C44H32FNO4 — CID 166717218
18-(4-fluorophenyl)-5-(4-methoxyphenyl)-21,24,24-trimethyl-5-phenyl-6-oxa-18-azahexacyclo[12.10.0.02,7.08,13.015,23.016,20]tetracosa-1(14),2(7),3,8,10,12,15(23),16(20),21-nonaene-17,19-dione (PubChem CID 166717218) has the molecular formula C44H32FNO4 and a molecular weight of 657.74 g/mol. Its IUPAC name is 18-(4-fluorophenyl)-5-(4-methoxyphenyl)-21,24,24-trimethyl-5-phenyl-6-oxa-18-azahexacyclo[12.10.0.02,7.08,13.015,23.016,20]tetracosa-1(14),2(7),3,8,10,12,15(23),16(20),21-nonaene-17,19-dione.
| Compound Name | 18-(4-fluorophenyl)-5-(4-methoxyphenyl)-21,24,24-trimethyl-5-phenyl-6-oxa-18-azahexacyclo[12.10.0.02,7.08,13.015,23.016,20]tetracosa-1(14),2(7),3,8,10,12,15(23),16(20),21-nonaene-17,19-dione |
|---|---|
| PubChem CID | 166717218 |
| Molecular Formula | C44H32FNO4 |
| Molecular Weight | 657.74 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 18-(4-fluorophenyl)-5-(4-methoxyphenyl)-21,24,24-trimethyl-5-phenyl-6-oxa-18-azahexacyclo[12.10.0.02,7.08,13.015,23.016,20]tetracosa-1(14),2(7),3,8,10,12,15(23),16(20),21-nonaene-17,19-dione |
| SMILES | COc1ccc(C2(c3ccccc3)C=Cc3c4c(c5ccccc5c3O2)-c2c(cc(C)c3c2C(=O)N(c2ccc(F)cc2)C3=O)C4(C)C)cc1 |
| InChI | InChI=1S/C44H32FNO4/c1-25-24-34-37(38-35(25)41(47)46(42(38)48)29-18-16-28(45)17-19-29)36-31-12-8-9-13-32(31)40-33(39(36)43(34,2)3)22-23-44(50-40,26-10-6-5-7-11-26)27-14-20-30(49-4)21-15-27/h5-24H,1-4H3 |
| InChIKey | DMYOKYSKHYCQAO-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.74 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|